Question

Write the net ionic equation for the precipitation reaction that occurs when aqueous solutions of ammonium phosphate and nickel(II) acetate are combined.

Answer 1

FORMULA EQUATION

(NH4)3PO4(aq)+Ni(CH3COO)2(aq)➡️NH4CH3COO(aq)+Ni3(PO4)2(s)

In net ionic equation only those compounds or elements are written that undergo a chemical reaction

NET IONIC EQUATION

2PO4³-(aq) + 3Ni²+(aq) ➡️Ni3(PO4)2(s)

Answer 2

To determine the net ionic equation for the precipitation reaction between ammonium phosphate and nickel(II) acetate, we need to first write the balanced chemical equation and then identify the spectator ions. The net ionic equation includes only the ions that participate in the reaction and excludes the spectator ions.

The balanced chemical equation for the reaction between ammonium phosphate ((NH4)3PO4) and nickel(II) acetate (Ni(CH3COO)2) can be written as follows:

(NH4)3PO4(aq) + Ni(CH3COO)2(aq) → Ni3(PO4)2(s) + 6CH3COONH4(aq)

In this reaction, ammonium phosphate reacts with nickel(II) acetate to form solid nickel(II) phosphate (Ni3(PO4)2) and aqueous ammonium acetate (CH3COONH4).

To write the net ionic equation, we omit the spectator ions, which are the ions that appear on both sides of the equation without undergoing any change. In this case, the ammonium ions (NH4+) and acetate ions (CH3COO-) are spectator ions because they appear unchanged on both sides.

Thus, the net ionic equation for the precipitation reaction is:

3NH4+(aq) + PO4^3-(aq) + Ni^2+(aq) → Ni3(PO4)2(s)

This net ionic equation represents the specific ions involved in the precipitation reaction and focuses on the essential chemical changes that occur during the formation of solid nickel(II) phosphate.