Final answer:
The IUPAC name of CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2 is 5-ethyl-3,6-dimethyloctane.
Step-by-step explanation:
The IUPAC name of CH₃(CH₂)₃CH(CH₂CH₂CH₂)CH(CH₃)₂ is 5-ethyl-3,6-dimethyloctane.
To determine the IUPAC name, we start by numbering the longest carbon chain, which has eight carbons. We then identify the substituents and their positions on the main chain. In this case, we have an ethyl group attached to the fifth carbon and two methyl groups attached to the third and sixth carbons. Hence, the compound is named as 5-ethyl-3,6-dimethyloctane.