Question

For the following reaction, what is the size of the equilibrium constant? ch3cooh(aq) ⇌ h (aq) ch3coo-(aq)

1) k > 1
2) k < 1
3) k = 1

Answer 1

The equilibrium constant, Kc, for the given reaction is greater than 1.

Step-by-step explanation:

The equilibrium constant, often denoted as K, is a numerical value that expresses the ratio of concentrations of products to reactants at equilibrium in a chemical reaction.

The equilibrium constant, represented by Kc, can be determined by the expression:

Kc = [CH3COO-][H3O+]/[CH3COOH]

In this reaction, there is only one mole of CH3COO- and H3O+ formed for every mole of CH3COOH. Therefore, the concentration of the products will be greater than the concentration of the reactant, resulting in Kc > 1.